trilithium bis(fluoranyl) ethanedioate borate

Systemtic Name: trilithium bis(fluoranyl) ethanedioate borate Openeye Name: trilithium difluoro oxalate borate CAS Name: trilithium oxalic acid difluoro ester borate IUPAC Name: trilithium difluoro oxalate borate Traditional Name: trilithium oxalic acid difluoro ester borate Formula: C2BF2Li3O7 MolecularWeight: 205.648006

Click to see the large picture

Descriptors Computed from Structure

Canonical SMILES:

[Li+].[Li+].[Li+].B([O-])([O-])[O-].C(=O)(C(=O)OF)OF

Isomeric SMILES

[Li+].[Li+].[Li+].B([O-])([O-])[O-].C(=O)(C(=O)OF)OF

InChI

InChI=1S/C2F2O4.BO3.3Li/c3-7-1(5)2(6)8-4;2-1(3)4;;;/q;-3;3*+1