potassium sulfur dioxide permanganate

Systemtic Name: potassium sulfur dioxide permanganate Openeye Name: potassium sulfur dioxide permanganate CAS Name: potassium sulfur dioxide permanganate IUPAC Name: potassium sulfur dioxide permanganate Traditional Name: potassium sulfur dioxide permanganate Formula: KMnO6S MolecularWeight: 222.097749

Click to see the large picture

Descriptors Computed from Structure

Canonical SMILES:

[O-][Mn](=O)(=O)=O.O=S=O.[K+]

Isomeric SMILES

[O-][Mn](=O)(=O)=O.O=S=O.[K+]

InChI

InChI=1S/K.Mn.O2S.4O/c;;1-3-2;;;;/q+1;;;;;;-1