hydron; (phenylmethyl) 6-methylpiperidine-2-carboxylate; chloride

Systemtic Name: hydron; (phenylmethyl) 6-methylpiperidine-2-carboxylate; chloride Openeye Name: benzyl 6-methylpiperidine-2-carboxylate; hydron; chloride CAS Name: hydron; 6-methyl-2-piperidinecarboxylic acid (phenylmethyl) ester; chloride IUPAC Name: benzyl 6-methylpiperidine-2-carboxylate; hydron; chloride Traditional Name: hydron; 6-methylpipecolinic acid benzyl ester; chloride Formula: C14H20ClNO2 MolecularWeight: 269.7671

Click to see the large picture

Descriptors Computed from Structure

Canonical SMILES:

[H+].CC1CCCC(N1)C(=O)OCC2=CC=CC=C2.[Cl-]

Isomeric SMILES

[H+].CC1CCCC(N1)C(=O)OCC2=CC=CC=C2.[Cl-]

InChI

InChI=1S/C14H19NO2.ClH/c1-11-6-5-9-13(15-11)14(16)17-10-12-7-3-2-4-8-12;/h2-4,7-8,11,13,15H,5-6,9-10H2,1H3;1H