hydron; methyl 2-(2-azanyl-1,3-thiazol-4-yl)ethanoate; chloride

Systemtic Name: hydron; methyl 2-(2-azanyl-1,3-thiazol-4-yl)ethanoate; chloride Openeye Name: hydron; methyl 2-(2-aminothiazol-4-yl)acetate; chloride CAS Name: 2-(2-amino-4-thiazolyl)acetic acid methyl ester; hydron; chloride IUPAC Name: hydron; methyl 2-(2-amino-1,3-thiazol-4-yl)acetate; chloride Traditional Name: 2-(2-aminothiazol-4-yl)acetic acid methyl ester; hydron; chloride Formula: C6H9ClN2O2S MolecularWeight: 208.66586

Click to see the large picture

Descriptors Computed from Structure

Canonical SMILES:

[H+].COC(=O)CC1=CSC(=N1)N.[Cl-]

Isomeric SMILES

[H+].COC(=O)CC1=CSC(=N1)N.[Cl-]

InChI

InChI=1S/C6H8N2O2S.ClH/c1-10-5(9)2-4-3-11-6(7)8-4;/h3H,2H2,1H3,(H2,7,8);1H