ethyl 3-azanyl-3-(4-methoxyphenyl)propanoate; hydron; chloride

Systemtic Name: ethyl 3-azanyl-3-(4-methoxyphenyl)propanoate; hydron; chloride Openeye Name: ethyl 3-amino-3-(4-methoxyphenyl)propanoate; hydron; chloride CAS Name: 3-amino-3-(4-methoxyphenyl)propanoic acid ethyl ester; hydron; chloride IUPAC Name: ethyl 3-amino-3-(4-methoxyphenyl)propanoate; hydron; chloride Traditional Name: 3-amino-3-(4-methoxyphenyl)propionic acid ethyl ester; hydron; chloride Formula: C12H18ClNO3 MolecularWeight: 259.72922

Click to see the large picture

Descriptors Computed from Structure

Canonical SMILES:

[H+].CCOC(=O)CC(C1=CC=C(C=C1)OC)N.[Cl-]

Isomeric SMILES

[H+].CCOC(=O)CC(C1=CC=C(C=C1)OC)N.[Cl-]

InChI

InChI=1S/C12H17NO3.ClH/c1-3-16-12(14)8-11(13)9-4-6-10(15-2)7-5-9;/h4-7,11H,3,8,13H2,1-2H3;1H