dicyclohexyl 2-azanylbutanedioate; hydron; chloride

Systemtic Name: dicyclohexyl 2-azanylbutanedioate; hydron; chloride Openeye Name: dicyclohexyl 2-aminobutanedioate; hydron; chloride CAS Name: 2-aminobutanedioic acid dicyclohexyl ester; hydron; chloride IUPAC Name: dicyclohexyl 2-aminobutanedioate; hydron; chloride Traditional Name: 2-aminosuccinic acid dicyclohexyl ester; hydron; chloride Formula: C16H28ClNO4 MolecularWeight: 333.85082

Click to see the large picture

Descriptors Computed from Structure

Canonical SMILES:

[H+].C1CCC(CC1)OC(=O)CC(C(=O)OC2CCCCC2)N.[Cl-]

Isomeric SMILES

[H+].C1CCC(CC1)OC(=O)CC(C(=O)OC2CCCCC2)N.[Cl-]

InChI

InChI=1S/C16H27NO4.ClH/c17-14(16(19)21-13-9-5-2-6-10-13)11-15(18)20-12-7-3-1-4-8-12;/h12-14H,1-11,17H2;1H