chloranyl nitrate; oxidanyl nitrate

Systemtic Name: chloranyl nitrate; oxidanyl nitrate Openeye Name: chloro nitrate; hydroxy nitrate CAS Name: nitric acid chloro ester; nitric acid hydroxy ester IUPAC Name: chloro nitrate; hydroxy nitrate Traditional Name: nitric acid chloro ester; nitric acid hydroxy ester Formula: ClHN2O7 MolecularWeight: 176.47014

Click to see the large picture

Descriptors Computed from Structure

Canonical SMILES:

[N+](=O)([O-])OO.[N+](=O)([O-])OCl

Isomeric SMILES

[N+](=O)([O-])OO.[N+](=O)([O-])OCl

InChI

InChI=1S/ClNO3.HNO4/c1-5-2(3)4;2-1(3)5-4/h;4H