bis(1-methylpiperidin-3-yl) hexanedioate; hydron; chloride

Systemtic Name: bis(1-methylpiperidin-3-yl) hexanedioate; hydron; chloride Openeye Name: bis(1-methyl-3-piperidyl) hexanedioate; hydron; chloride CAS Name: hexanedioic acid bis(1-methyl-3-piperidinyl) ester; hydron; chloride IUPAC Name: bis(1-methylpiperidin-3-yl) hexanedioate; hydron; chloride Traditional Name: adipic acid bis(1-methyl-3-piperidyl) ester; hydron; chloride Formula: C18H33ClN2O4 MolecularWeight: 376.91862

Click to see the large picture

Descriptors Computed from Structure

Canonical SMILES:

[H+].CN1CCCC(C1)OC(=O)CCCCC(=O)OC2CCCN(C2)C.[Cl-]

Isomeric SMILES

[H+].CN1CCCC(C1)OC(=O)CCCCC(=O)OC2CCCN(C2)C.[Cl-]

InChI

InChI=1S/C18H32N2O4.ClH/c1-19-11-5-7-15(13-19)23-17(21)9-3-4-10-18(22)24-16-8-6-12-20(2)14-16;/h15-16H,3-14H2,1-2H3;1H